C26H24N2O3 — CID 60553477
N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2-(2-phenylethyl)benzamide (PubChem CID 60553477) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2-(2-phenylethyl)benzamide.
| Compound Name | N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 60553477 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2-(2-phenylethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2C(=O)CCCC2=O)cc1)c1ccccc1CCc1ccccc1 |
| InChI | InChI=1S/C26H24N2O3/c29-24-11-6-12-25(30)28(24)22-17-15-21(16-18-22)27-26(31)23-10-5-4-9-20(23)14-13-19-7-2-1-3-8-19/h1-5,7-10,15-18H,6,11-14H2,(H,27,31) |
| InChIKey | HDYARYJMZVJKOV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|