C22H22N2O3 — CID 75421720
(E)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-5-phenylpent-4-enamide (PubChem CID 75421720) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is (E)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-5-phenylpent-4-enamide.
| Compound Name | (E)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-5-phenylpent-4-enamide |
|---|---|
| PubChem CID | 75421720 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (E)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-5-phenylpent-4-enamide |
| SMILES | O=C(CC/C=C/c1ccccc1)Nc1ccc(N2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C22H22N2O3/c25-20(10-5-4-9-17-7-2-1-3-8-17)23-18-13-15-19(16-14-18)24-21(26)11-6-12-22(24)27/h1-4,7-9,13-16H,5-6,10-12H2,(H,23,25)/b9-4+ |
| InChIKey | PSZVTDNHEWPSDQ-RUDMXATFSA-N |
| XLogP | 4.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|