C19H20N4O5 — CID 51115082
N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide (PubChem CID 51115082) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide.
| Compound Name | N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 51115082 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1ccc(N2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C19H20N4O5/c1-11-14(18(27)22-19(28)20-11)9-10-15(24)21-12-5-7-13(8-6-12)23-16(25)3-2-4-17(23)26/h5-8H,2-4,9-10H2,1H3,(H,21,24)(H2,20,22,27,28) |
| InChIKey | QMWAQTDQURRLGJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 132.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|