C21H18N4O3 — CID 55549916
3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]propanamide (PubChem CID 55549916) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]propanamide.
| Compound Name | 3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55549916 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]propanamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)Nc1cccc(C#Cc2ccccn2)c1 |
| InChI | InChI=1S/C21H18N4O3/c1-14-18(20(27)25-21(28)23-14)10-11-19(26)24-17-7-4-5-15(13-17)8-9-16-6-2-3-12-22-16/h2-7,12-13H,10-11H2,1H3,(H,24,26)(H2,23,25,27,28) |
| InChIKey | AUQYNTLJPZFYLU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|