C20H15N3O3 — CID 25331932
N-[2-oxo-2-[3-(2-pyridin-2-ylethynyl)anilino]ethyl]furan-2-carboxamide (PubChem CID 25331932) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[2-oxo-2-[3-(2-pyridin-2-ylethynyl)anilino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-oxo-2-[3-(2-pyridin-2-ylethynyl)anilino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25331932 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[2-oxo-2-[3-(2-pyridin-2-ylethynyl)anilino]ethyl]furan-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccco1)Nc1cccc(C#Cc2ccccn2)c1 |
| InChI | InChI=1S/C20H15N3O3/c24-19(14-22-20(25)18-8-4-12-26-18)23-17-7-3-5-15(13-17)9-10-16-6-1-2-11-21-16/h1-8,11-13H,14H2,(H,22,25)(H,23,24) |
| InChIKey | NBHSMAHCUALEGA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|