C21H16BrN3O2S — CID 55823120
5-bromo-N-methyl-N-[2-oxo-2-[3-(2-pyridin-2-ylethynyl)anilino]ethyl]thiophene-2-carboxamide (PubChem CID 55823120) has the molecular formula C21H16BrN3O2S and a molecular weight of 454.35 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-[2-oxo-2-[3-(2-pyridin-2-ylethynyl)anilino]ethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-methyl-N-[2-oxo-2-[3-(2-pyridin-2-ylethynyl)anilino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55823120 |
| Molecular Formula | C21H16BrN3O2S |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | 5-bromo-N-methyl-N-[2-oxo-2-[3-(2-pyridin-2-ylethynyl)anilino]ethyl]thiophene-2-carboxamide |
| SMILES | CN(CC(=O)Nc1cccc(C#Cc2ccccn2)c1)C(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C21H16BrN3O2S/c1-25(21(27)18-10-11-19(22)28-18)14-20(26)24-17-7-4-5-15(13-17)8-9-16-6-2-3-12-23-16/h2-7,10-13H,14H2,1H3,(H,24,26) |
| InChIKey | MGUBFRHFJQPZSN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|