C23H19N3O3 — CID 168957709
methyl N-methyl-N-[4-[[3-(2-pyridin-2-ylethynyl)phenyl]carbamoyl]phenyl]carbamate (PubChem CID 168957709) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is methyl N-methyl-N-[4-[[3-(2-pyridin-2-ylethynyl)phenyl]carbamoyl]phenyl]carbamate.
| Compound Name | methyl N-methyl-N-[4-[[3-(2-pyridin-2-ylethynyl)phenyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 168957709 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | methyl N-methyl-N-[4-[[3-(2-pyridin-2-ylethynyl)phenyl]carbamoyl]phenyl]carbamate |
| SMILES | COC(=O)N(C)c1ccc(C(=O)Nc2cccc(C#Cc3ccccn3)c2)cc1 |
| InChI | InChI=1S/C23H19N3O3/c1-26(23(28)29-2)21-13-10-18(11-14-21)22(27)25-20-8-5-6-17(16-20)9-12-19-7-3-4-15-24-19/h3-8,10-11,13-16H,1-2H3,(H,25,27) |
| InChIKey | TVUYGKFPNRKKCK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|