C25H19F2N3O2 — CID 168957732
4-(5,5-difluoro-2-oxopiperidin-1-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide (PubChem CID 168957732) has the molecular formula C25H19F2N3O2 and a molecular weight of 431.44 g/mol. Its IUPAC name is 4-(5,5-difluoro-2-oxopiperidin-1-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide.
| Compound Name | 4-(5,5-difluoro-2-oxopiperidin-1-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide |
|---|---|
| PubChem CID | 168957732 |
| Molecular Formula | C25H19F2N3O2 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-(5,5-difluoro-2-oxopiperidin-1-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C#Cc2ccccn2)c1)c1ccc(N2CC(F)(F)CCC2=O)cc1 |
| InChI | InChI=1S/C25H19F2N3O2/c26-25(27)14-13-23(31)30(17-25)22-11-8-19(9-12-22)24(32)29-21-6-3-4-18(16-21)7-10-20-5-1-2-15-28-20/h1-6,8-9,11-12,15-16H,13-14,17H2,(H,29,32) |
| InChIKey | HKNDFRXNBGWKHX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|