C27H22N4O — CID 37030532
1-(4-methylphenyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide (PubChem CID 37030532) has the molecular formula C27H22N4O and a molecular weight of 418.50 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 37030532 |
| Molecular Formula | C27H22N4O |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-(4-methylphenyl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxamide |
| SMILES | Cc1ccc(-n2nc(C(=O)Nc3cccc(C#Cc4ccccn4)c3)c3c2CCC3)cc1 |
| InChI | InChI=1S/C27H22N4O/c1-19-11-15-23(16-12-19)31-25-10-5-9-24(25)26(30-31)27(32)29-22-8-4-6-20(18-22)13-14-21-7-2-3-17-28-21/h2-4,6-8,11-12,15-18H,5,9-10H2,1H3,(H,29,32) |
| InChIKey | HLJSJZXJCYBPPN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|