C20H13FN2O — CID 18225707
4-fluoro-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide (PubChem CID 18225707) has the molecular formula C20H13FN2O and a molecular weight of 316.34 g/mol. Its IUPAC name is 4-fluoro-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide |
|---|---|
| PubChem CID | 18225707 |
| Molecular Formula | C20H13FN2O |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-fluoro-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C#Cc2ccccn2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H13FN2O/c21-17-10-8-16(9-11-17)20(24)23-19-6-3-4-15(14-19)7-12-18-5-1-2-13-22-18/h1-6,8-11,13-14H,(H,23,24) |
| InChIKey | YOEJFWUUGPMQCU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|