C24H22N2O — CID 168817074
N-(4-tert-butylphenyl)-3-(2-pyridin-2-ylethynyl)benzamide (PubChem CID 168817074) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-3-(2-pyridin-2-ylethynyl)benzamide.
| Compound Name | N-(4-tert-butylphenyl)-3-(2-pyridin-2-ylethynyl)benzamide |
|---|---|
| PubChem CID | 168817074 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-(4-tert-butylphenyl)-3-(2-pyridin-2-ylethynyl)benzamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2cccc(C#Cc3ccccn3)c2)cc1 |
| InChI | InChI=1S/C24H22N2O/c1-24(2,3)20-11-14-22(15-12-20)26-23(27)19-8-6-7-18(17-19)10-13-21-9-4-5-16-25-21/h4-9,11-12,14-17H,1-3H3,(H,26,27) |
| InChIKey | UGMKZPVRJUHUTB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|