C23H19N3OS — CID 170014783
3-(2-pyridin-2-ylethynyl)-N-[4-(1,2-thiazolidin-2-yl)phenyl]benzamide (PubChem CID 170014783) has the molecular formula C23H19N3OS and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-(2-pyridin-2-ylethynyl)-N-[4-(1,2-thiazolidin-2-yl)phenyl]benzamide.
| Compound Name | 3-(2-pyridin-2-ylethynyl)-N-[4-(1,2-thiazolidin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 170014783 |
| Molecular Formula | C23H19N3OS |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3-(2-pyridin-2-ylethynyl)-N-[4-(1,2-thiazolidin-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCCS2)cc1)c1cccc(C#Cc2ccccn2)c1 |
| InChI | InChI=1S/C23H19N3OS/c27-23(25-21-10-12-22(13-11-21)26-15-4-16-28-26)19-6-3-5-18(17-19)8-9-20-7-1-2-14-24-20/h1-3,5-7,10-14,17H,4,15-16H2,(H,25,27) |
| InChIKey | GZJWFHDHVTWEIP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|