C22H16N2OS — CID 134053142
N-[3-(2-pyridin-2-ylethynyl)phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 134053142) has the molecular formula C22H16N2OS and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[3-(2-pyridin-2-ylethynyl)phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-(2-pyridin-2-ylethynyl)phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 134053142 |
| Molecular Formula | C22H16N2OS |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[3-(2-pyridin-2-ylethynyl)phenyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(C#Cc2ccccn2)c1)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C22H16N2OS/c25-22(21-15-17-7-1-2-10-20(17)26-21)24-19-9-5-6-16(14-19)11-12-18-8-3-4-13-23-18/h1-10,13-14,21H,15H2,(H,24,25) |
| InChIKey | KNKIZWKUXCDNTD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|