C23H17N3O2S — CID 134053094
2-(3-oxo-1,4-benzothiazin-4-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide (PubChem CID 134053094) has the molecular formula C23H17N3O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is 2-(3-oxo-1,4-benzothiazin-4-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide.
| Compound Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 134053094 |
| Molecular Formula | C23H17N3O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-(3-oxo-1,4-benzothiazin-4-yl)-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)Nc1cccc(C#Cc2ccccn2)c1 |
| InChI | InChI=1S/C23H17N3O2S/c27-22(15-26-20-9-1-2-10-21(20)29-16-23(26)28)25-19-8-5-6-17(14-19)11-12-18-7-3-4-13-24-18/h1-10,13-14H,15-16H2,(H,25,27) |
| InChIKey | LIWFSFFKPXNELG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|