C23H20N2O2 — CID 134053013
4-phenoxy-N-[3-(2-pyridin-2-ylethynyl)phenyl]butanamide (PubChem CID 134053013) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-phenoxy-N-[3-(2-pyridin-2-ylethynyl)phenyl]butanamide.
| Compound Name | 4-phenoxy-N-[3-(2-pyridin-2-ylethynyl)phenyl]butanamide |
|---|---|
| PubChem CID | 134053013 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-phenoxy-N-[3-(2-pyridin-2-ylethynyl)phenyl]butanamide |
| SMILES | O=C(CCCOc1ccccc1)Nc1cccc(C#Cc2ccccn2)c1 |
| InChI | InChI=1S/C23H20N2O2/c26-23(13-7-17-27-22-11-2-1-3-12-22)25-21-10-6-8-19(18-21)14-15-20-9-4-5-16-24-20/h1-6,8-12,16,18H,7,13,17H2,(H,25,26) |
| InChIKey | LYFZBYMTCCSMAZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|