C26H21N5O2 — CID 55987614
3-(3-imidazol-1-ylpropanoylamino)-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide (PubChem CID 55987614) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is 3-(3-imidazol-1-ylpropanoylamino)-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide.
| Compound Name | 3-(3-imidazol-1-ylpropanoylamino)-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55987614 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-(3-imidazol-1-ylpropanoylamino)-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide |
| SMILES | O=C(CCn1ccnc1)Nc1cccc(C(=O)Nc2cccc(C#Cc3ccccn3)c2)c1 |
| InChI | InChI=1S/C26H21N5O2/c32-25(12-15-31-16-14-27-19-31)29-24-9-4-6-21(18-24)26(33)30-23-8-3-5-20(17-23)10-11-22-7-1-2-13-28-22/h1-9,13-14,16-19H,12,15H2,(H,29,32)(H,30,33) |
| InChIKey | UVCORKIFQFCTTP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|