C21H19ClN4O4 — CID 55985393
methyl 2-chloro-5-[[3-(3-imidazol-1-ylpropanoylamino)benzoyl]amino]benzoate (PubChem CID 55985393) has the molecular formula C21H19ClN4O4 and a molecular weight of 426.86 g/mol. Its IUPAC name is methyl 2-chloro-5-[[3-(3-imidazol-1-ylpropanoylamino)benzoyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[3-(3-imidazol-1-ylpropanoylamino)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 55985393 |
| Molecular Formula | C21H19ClN4O4 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | methyl 2-chloro-5-[[3-(3-imidazol-1-ylpropanoylamino)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2cccc(NC(=O)CCn3ccnc3)c2)ccc1Cl |
| InChI | InChI=1S/C21H19ClN4O4/c1-30-21(29)17-12-16(5-6-18(17)22)25-20(28)14-3-2-4-15(11-14)24-19(27)7-9-26-10-8-23-13-26/h2-6,8,10-13H,7,9H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | UPRSENMMVHXJSF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |