C17H25Cl2N5O2 — CID 119505500
N-[2-(ethylamino)ethyl]-3-(3-imidazol-1-ylpropanoylamino)benzamide;dihydrochloride (PubChem CID 119505500) has the molecular formula C17H25Cl2N5O2 and a molecular weight of 402.33 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3-(3-imidazol-1-ylpropanoylamino)benzamide;dihydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-3-(3-imidazol-1-ylpropanoylamino)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119505500 |
| Molecular Formula | C17H25Cl2N5O2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3-(3-imidazol-1-ylpropanoylamino)benzamide;dihydrochloride |
| SMILES | CCNCCNC(=O)c1cccc(NC(=O)CCn2ccnc2)c1.Cl.Cl |
| InChI | InChI=1S/C17H23N5O2.2ClH/c1-2-18-7-8-20-17(24)14-4-3-5-15(12-14)21-16(23)6-10-22-11-9-19-13-22;;/h3-5,9,11-13,18H,2,6-8,10H2,1H3,(H,20,24)(H,21,23);2*1H |
| InChIKey | AVFZHMHJVFVXBO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|