C20H28N6O2 — CID 119391382
3-(3-imidazol-1-ylpropanoylamino)-N-(3-piperazin-1-ylpropyl)benzamide (PubChem CID 119391382) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-(3-imidazol-1-ylpropanoylamino)-N-(3-piperazin-1-ylpropyl)benzamide.
| Compound Name | 3-(3-imidazol-1-ylpropanoylamino)-N-(3-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 119391382 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 3-(3-imidazol-1-ylpropanoylamino)-N-(3-piperazin-1-ylpropyl)benzamide |
| SMILES | O=C(CCn1ccnc1)Nc1cccc(C(=O)NCCCN2CCNCC2)c1 |
| InChI | InChI=1S/C20H28N6O2/c27-19(5-11-26-14-9-22-16-26)24-18-4-1-3-17(15-18)20(28)23-6-2-10-25-12-7-21-8-13-25/h1,3-4,9,14-16,21H,2,5-8,10-13H2,(H,23,28)(H,24,27) |
| InChIKey | CIZZLRPWLIJOPG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|