C19H23N7O2S — CID 56562204
N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(3-imidazol-1-ylpropanoylamino)benzamide (PubChem CID 56562204) has the molecular formula C19H23N7O2S and a molecular weight of 413.51 g/mol. Its IUPAC name is N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(3-imidazol-1-ylpropanoylamino)benzamide.
| Compound Name | N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(3-imidazol-1-ylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 56562204 |
| Molecular Formula | C19H23N7O2S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(3-imidazol-1-ylpropanoylamino)benzamide |
| SMILES | CCn1c(CCNC(=O)c2cccc(NC(=O)CCn3ccnc3)c2)n[nH]c1=S |
| InChI | InChI=1S/C19H23N7O2S/c1-2-26-16(23-24-19(26)29)6-8-21-18(28)14-4-3-5-15(12-14)22-17(27)7-10-25-11-9-20-13-25/h3-5,9,11-13H,2,6-8,10H2,1H3,(H,21,28)(H,22,27)(H,24,29) |
| InChIKey | MOJKHDKCUGQTEN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|