C26H22N4O3 — CID 134053060
2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide (PubChem CID 134053060) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide.
| Compound Name | 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide |
|---|---|
| PubChem CID | 134053060 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-[4-methyl-4-(4-methylphenyl)-2,5-dioxoimidazolidin-1-yl]-N-[3-(2-pyridin-2-ylethynyl)phenyl]acetamide |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)Nc3cccc(C#Cc4ccccn4)c3)C2=O)cc1 |
| InChI | InChI=1S/C26H22N4O3/c1-18-9-12-20(13-10-18)26(2)24(32)30(25(33)29-26)17-23(31)28-22-8-5-6-19(16-22)11-14-21-7-3-4-15-27-21/h3-10,12-13,15-16H,17H2,1-2H3,(H,28,31)(H,29,33) |
| InChIKey | KMWNWUNBYPTNMH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|