C25H20FN3O2S — CID 95568926
(3S,6S)-6-[(2-fluorophenyl)methyl]-5-oxo-N-[3-(2-pyridin-2-ylethynyl)phenyl]thiomorpholine-3-carboxamide (PubChem CID 95568926) has the molecular formula C25H20FN3O2S and a molecular weight of 445.52 g/mol. Its IUPAC name is (3S,6S)-6-[(2-fluorophenyl)methyl]-5-oxo-N-[3-(2-pyridin-2-ylethynyl)phenyl]thiomorpholine-3-carboxamide.
| Compound Name | (3S,6S)-6-[(2-fluorophenyl)methyl]-5-oxo-N-[3-(2-pyridin-2-ylethynyl)phenyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 95568926 |
| Molecular Formula | C25H20FN3O2S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (3S,6S)-6-[(2-fluorophenyl)methyl]-5-oxo-N-[3-(2-pyridin-2-ylethynyl)phenyl]thiomorpholine-3-carboxamide |
| SMILES | O=C1N[C@@H](C(=O)Nc2cccc(C#Cc3ccccn3)c2)CS[C@H]1Cc1ccccc1F |
| InChI | InChI=1S/C25H20FN3O2S/c26-21-10-2-1-7-18(21)15-23-25(31)29-22(16-32-23)24(30)28-20-9-5-6-17(14-20)11-12-19-8-3-4-13-27-19/h1-10,13-14,22-23H,15-16H2,(H,28,30)(H,29,31)/t22-,23+/m1/s1 |
| InChIKey | CWLSFHPZQJZSNI-PKTZIBPZSA-N |
| XLogP | 3.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|