C13H15FN2O3S — CID 94014377
(3S,6R)-6-[(2-fluorophenyl)methyl]-N-methoxy-5-oxothiomorpholine-3-carboxamide (PubChem CID 94014377) has the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. Its IUPAC name is (3S,6R)-6-[(2-fluorophenyl)methyl]-N-methoxy-5-oxothiomorpholine-3-carboxamide.
| Compound Name | (3S,6R)-6-[(2-fluorophenyl)methyl]-N-methoxy-5-oxothiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 94014377 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (3S,6R)-6-[(2-fluorophenyl)methyl]-N-methoxy-5-oxothiomorpholine-3-carboxamide |
| SMILES | CONC(=O)[C@H]1CS[C@H](Cc2ccccc2F)C(=O)N1 |
| InChI | InChI=1S/C13H15FN2O3S/c1-19-16-12(17)10-7-20-11(13(18)15-10)6-8-4-2-3-5-9(8)14/h2-5,10-11H,6-7H2,1H3,(H,15,18)(H,16,17)/t10-,11-/m1/s1 |
| InChIKey | RZKRXRSGCGEXHG-GHMZBOCLSA-N |
| XLogP | 0.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|