C16H21FN2O3S — CID 36741881
(3R,6R)-6-[(2-fluorophenyl)methyl]-N-(3-methoxypropyl)-5-oxothiomorpholine-3-carboxamide (PubChem CID 36741881) has the molecular formula C16H21FN2O3S and a molecular weight of 340.42 g/mol. Its IUPAC name is (3R,6R)-6-[(2-fluorophenyl)methyl]-N-(3-methoxypropyl)-5-oxothiomorpholine-3-carboxamide.
| Compound Name | (3R,6R)-6-[(2-fluorophenyl)methyl]-N-(3-methoxypropyl)-5-oxothiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 36741881 |
| Molecular Formula | C16H21FN2O3S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (3R,6R)-6-[(2-fluorophenyl)methyl]-N-(3-methoxypropyl)-5-oxothiomorpholine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@@H]1CS[C@H](Cc2ccccc2F)C(=O)N1 |
| InChI | InChI=1S/C16H21FN2O3S/c1-22-8-4-7-18-15(20)13-10-23-14(16(21)19-13)9-11-5-2-3-6-12(11)17/h2-3,5-6,13-14H,4,7-10H2,1H3,(H,18,20)(H,19,21)/t13-,14+/m0/s1 |
| InChIKey | ZOXUKBCJSGVMSP-UONOGXRCSA-N |
| XLogP | 1.12 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|