C17H23FN2O3S — CID 24672365
N-(3-ethoxypropyl)-6-[(4-fluorophenyl)methyl]-5-oxothiomorpholine-3-carboxamide (PubChem CID 24672365) has the molecular formula C17H23FN2O3S and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-6-[(4-fluorophenyl)methyl]-5-oxothiomorpholine-3-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-6-[(4-fluorophenyl)methyl]-5-oxothiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 24672365 |
| Molecular Formula | C17H23FN2O3S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(3-ethoxypropyl)-6-[(4-fluorophenyl)methyl]-5-oxothiomorpholine-3-carboxamide |
| SMILES | CCOCCCNC(=O)C1CSC(Cc2ccc(F)cc2)C(=O)N1 |
| InChI | InChI=1S/C17H23FN2O3S/c1-2-23-9-3-8-19-16(21)14-11-24-15(17(22)20-14)10-12-4-6-13(18)7-5-12/h4-7,14-15H,2-3,8-11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | YWXGEAKIGJUPHG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|