C18H25FN4O2S — CID 119444906
6-[(2-fluorophenyl)methyl]-5-oxo-N-(2-piperazin-1-ylethyl)thiomorpholine-3-carboxamide (PubChem CID 119444906) has the molecular formula C18H25FN4O2S and a molecular weight of 380.49 g/mol. Its IUPAC name is 6-[(2-fluorophenyl)methyl]-5-oxo-N-(2-piperazin-1-ylethyl)thiomorpholine-3-carboxamide.
| Compound Name | 6-[(2-fluorophenyl)methyl]-5-oxo-N-(2-piperazin-1-ylethyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 119444906 |
| Molecular Formula | C18H25FN4O2S |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 6-[(2-fluorophenyl)methyl]-5-oxo-N-(2-piperazin-1-ylethyl)thiomorpholine-3-carboxamide |
| SMILES | O=C(NCCN1CCNCC1)C1CSC(Cc2ccccc2F)C(=O)N1 |
| InChI | InChI=1S/C18H25FN4O2S/c19-14-4-2-1-3-13(14)11-16-18(25)22-15(12-26-16)17(24)21-7-10-23-8-5-20-6-9-23/h1-4,15-16,20H,5-12H2,(H,21,24)(H,22,25) |
| InChIKey | DMOBCWNZGXBWFW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |