C19H19FN2O3S — CID 42946181
6-[(2-fluorophenyl)methyl]-5-oxo-N-phenylmethoxythiomorpholine-3-carboxamide (PubChem CID 42946181) has the molecular formula C19H19FN2O3S and a molecular weight of 374.44 g/mol. Its IUPAC name is 6-[(2-fluorophenyl)methyl]-5-oxo-N-phenylmethoxythiomorpholine-3-carboxamide.
| Compound Name | 6-[(2-fluorophenyl)methyl]-5-oxo-N-phenylmethoxythiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 42946181 |
| Molecular Formula | C19H19FN2O3S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 6-[(2-fluorophenyl)methyl]-5-oxo-N-phenylmethoxythiomorpholine-3-carboxamide |
| SMILES | O=C(NOCc1ccccc1)C1CSC(Cc2ccccc2F)C(=O)N1 |
| InChI | InChI=1S/C19H19FN2O3S/c20-15-9-5-4-8-14(15)10-17-19(24)21-16(12-26-17)18(23)22-25-11-13-6-2-1-3-7-13/h1-9,16-17H,10-12H2,(H,21,24)(H,22,23) |
| InChIKey | CRURZDPZHKYCQS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|