C26H23N3O2 — CID 168957701
N-[3-methyl-5-(2-pyridin-2-ylethynyl)phenyl]-4-(2-oxopiperidin-1-yl)benzamide (PubChem CID 168957701) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[3-methyl-5-(2-pyridin-2-ylethynyl)phenyl]-4-(2-oxopiperidin-1-yl)benzamide.
| Compound Name | N-[3-methyl-5-(2-pyridin-2-ylethynyl)phenyl]-4-(2-oxopiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 168957701 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-[3-methyl-5-(2-pyridin-2-ylethynyl)phenyl]-4-(2-oxopiperidin-1-yl)benzamide |
| SMILES | Cc1cc(C#Cc2ccccn2)cc(NC(=O)c2ccc(N3CCCCC3=O)cc2)c1 |
| InChI | InChI=1S/C26H23N3O2/c1-19-16-20(8-11-22-6-2-4-14-27-22)18-23(17-19)28-26(31)21-9-12-24(13-10-21)29-15-5-3-7-25(29)30/h2,4,6,9-10,12-14,16-18H,3,5,7,15H2,1H3,(H,28,31) |
| InChIKey | YYKRMVABVIXORF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|