C20H12BrFN2O — CID 55718669
3-bromo-5-fluoro-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide (PubChem CID 55718669) has the molecular formula C20H12BrFN2O and a molecular weight of 395.23 g/mol. Its IUPAC name is 3-bromo-5-fluoro-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide.
| Compound Name | 3-bromo-5-fluoro-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55718669 |
| Molecular Formula | C20H12BrFN2O |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 3-bromo-5-fluoro-N-[3-(2-pyridin-2-ylethynyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C#Cc2ccccn2)c1)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C20H12BrFN2O/c21-16-11-15(12-17(22)13-16)20(25)24-19-6-3-4-14(10-19)7-8-18-5-1-2-9-23-18/h1-6,9-13H,(H,24,25) |
| InChIKey | MXEHGSMGMHNNBB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|