C13H8BrF2NO — CID 3660841
N-(3-bromophenyl)-3,5-difluorobenzamide (PubChem CID 3660841) has the molecular formula C13H8BrF2NO and a molecular weight of 312.11 g/mol. Its IUPAC name is N-(3-bromophenyl)-3,5-difluorobenzamide.
| Compound Name | N-(3-bromophenyl)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 3660841 |
| Molecular Formula | C13H8BrF2NO |
| Molecular Weight | 312.11 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | N-(3-bromophenyl)-3,5-difluorobenzamide |
| SMILES | O=C(Nc1cccc(Br)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H8BrF2NO/c14-9-2-1-3-12(6-9)17-13(18)8-4-10(15)7-11(16)5-8/h1-7H,(H,17,18) |
| InChIKey | WVPVAKGLBWIMHB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.11 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |