C14H11BrN2O2 — CID 30844565
4-N-(3-bromophenyl)benzene-1,4-dicarboxamide (PubChem CID 30844565) has the molecular formula C14H11BrN2O2 and a molecular weight of 319.16 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(3-bromophenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 30844565 |
| Molecular Formula | C14H11BrN2O2 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 4-N-(3-bromophenyl)benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C14H11BrN2O2/c15-11-2-1-3-12(8-11)17-14(19)10-6-4-9(5-7-10)13(16)18/h1-8H,(H2,16,18)(H,17,19) |
| InChIKey | QDFDZVXCEGAOSH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |