C20H18N4O — CID 134053136
1,3,5-trimethyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrazole-4-carboxamide (PubChem CID 134053136) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 1,3,5-trimethyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134053136 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1,3,5-trimethyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)Nc1cccc(C#Cc2ccccn2)c1 |
| InChI | InChI=1S/C20H18N4O/c1-14-19(15(2)24(3)23-14)20(25)22-18-9-6-7-16(13-18)10-11-17-8-4-5-12-21-17/h4-9,12-13H,1-3H3,(H,22,25) |
| InChIKey | BWNQYSFIDCGWDX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|