C25H20N4O — CID 43066858
2,5-dimethyl-1-pyridin-2-yl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrrole-3-carboxamide (PubChem CID 43066858) has the molecular formula C25H20N4O and a molecular weight of 392.46 g/mol. Its IUPAC name is 2,5-dimethyl-1-pyridin-2-yl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-1-pyridin-2-yl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 43066858 |
| Molecular Formula | C25H20N4O |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2,5-dimethyl-1-pyridin-2-yl-N-[3-(2-pyridin-2-ylethynyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(C#Cc3ccccn3)c2)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C25H20N4O/c1-18-16-23(19(2)29(18)24-11-4-6-15-27-24)25(30)28-22-10-7-8-20(17-22)12-13-21-9-3-5-14-26-21/h3-11,14-17H,1-2H3,(H,28,30) |
| InChIKey | FJNFSVRDKAGKSR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|