C26H25N5O2 — CID 55838019
2,5-dimethyl-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]-1-pyridin-2-ylpyrrole-3-carboxamide (PubChem CID 55838019) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]-1-pyridin-2-ylpyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]-1-pyridin-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55838019 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2,5-dimethyl-N-[2-methyl-5-(phenylcarbamoylamino)phenyl]-1-pyridin-2-ylpyrrole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)Nc2ccccc2)cc1NC(=O)c1cc(C)n(-c2ccccn2)c1C |
| InChI | InChI=1S/C26H25N5O2/c1-17-12-13-21(29-26(33)28-20-9-5-4-6-10-20)16-23(17)30-25(32)22-15-18(2)31(19(22)3)24-11-7-8-14-27-24/h4-16H,1-3H3,(H,30,32)(H2,28,29,33) |
| InChIKey | MOESIYYUARDEKH-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|