C15H22Cl2N4O — CID 120509004
N-[(2S)-1-aminopropan-2-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride (PubChem CID 120509004) has the molecular formula C15H22Cl2N4O and a molecular weight of 345.27 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120509004 |
| Molecular Formula | C15H22Cl2N4O |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide;dihydrochloride |
| SMILES | Cc1cc(C(=O)N[C@@H](C)CN)c(C)n1-c1ccccn1.Cl.Cl |
| InChI | InChI=1S/C15H20N4O.2ClH/c1-10(9-16)18-15(20)13-8-11(2)19(12(13)3)14-6-4-5-7-17-14;;/h4-8,10H,9,16H2,1-3H3,(H,18,20);2*1H/t10-;;/m0../s1 |
| InChIKey | PMLJIVNZOPWXJM-XRIOVQLTSA-N |
| XLogP | 2.41 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|