C16H21BrClN3O — CID 120508435
N-[(2S)-1-aminopropan-2-yl]-1-(3-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide;hydrochloride (PubChem CID 120508435) has the molecular formula C16H21BrClN3O and a molecular weight of 386.72 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-1-(3-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide;hydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-1-(3-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120508435 |
| Molecular Formula | C16H21BrClN3O |
| Molecular Weight | 386.72 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-1-(3-bromophenyl)-2,5-dimethylpyrrole-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)N[C@@H](C)CN)c(C)n1-c1cccc(Br)c1.Cl |
| InChI | InChI=1S/C16H20BrN3O.ClH/c1-10(9-18)19-16(21)15-7-11(2)20(12(15)3)14-6-4-5-13(17)8-14;/h4-8,10H,9,18H2,1-3H3,(H,19,21);1H/t10-;/m0./s1 |
| InChIKey | AUXMGJCWEVAONI-PPHPATTJSA-N |
| XLogP | 3.36 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.72 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|