C16H17ClN4O3 — CID 60582355
2-[[1-(3-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]propanediamide (PubChem CID 60582355) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is 2-[[1-(3-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]propanediamide.
| Compound Name | 2-[[1-(3-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]propanediamide |
|---|---|
| PubChem CID | 60582355 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-[[1-(3-chlorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]propanediamide |
| SMILES | Cc1cc(C(=O)NC(C(N)=O)C(N)=O)c(C)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN4O3/c1-8-6-12(16(24)20-13(14(18)22)15(19)23)9(2)21(8)11-5-3-4-10(17)7-11/h3-7,13H,1-2H3,(H2,18,22)(H2,19,23)(H,20,24) |
| InChIKey | VKMQWAVXCHFWQV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|