C17H20N4O3 — CID 56807575
2-[(1-benzyl-2,5-dimethylpyrrole-3-carbonyl)amino]propanediamide (PubChem CID 56807575) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-[(1-benzyl-2,5-dimethylpyrrole-3-carbonyl)amino]propanediamide.
| Compound Name | 2-[(1-benzyl-2,5-dimethylpyrrole-3-carbonyl)amino]propanediamide |
|---|---|
| PubChem CID | 56807575 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-[(1-benzyl-2,5-dimethylpyrrole-3-carbonyl)amino]propanediamide |
| SMILES | Cc1cc(C(=O)NC(C(N)=O)C(N)=O)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H20N4O3/c1-10-8-13(17(24)20-14(15(18)22)16(19)23)11(2)21(10)9-12-6-4-3-5-7-12/h3-8,14H,9H2,1-2H3,(H2,18,22)(H2,19,23)(H,20,24) |
| InChIKey | JOSWOAVEFPSAPD-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|