C21H22N4O2 — CID 55528829
1-benzyl-N-[4-(carbamoylamino)phenyl]-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 55528829) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-benzyl-N-[4-(carbamoylamino)phenyl]-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-benzyl-N-[4-(carbamoylamino)phenyl]-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55528829 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-benzyl-N-[4-(carbamoylamino)phenyl]-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(NC(N)=O)cc2)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H22N4O2/c1-14-12-19(15(2)25(14)13-16-6-4-3-5-7-16)20(26)23-17-8-10-18(11-9-17)24-21(22)27/h3-12H,13H2,1-2H3,(H,23,26)(H3,22,24,27) |
| InChIKey | YBGWCEWQZCOONX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |