C10H9Cl2N3O3 — CID 25465611
2-[(2,3-dichlorobenzoyl)amino]propanediamide (PubChem CID 25465611) has the molecular formula C10H9Cl2N3O3 and a molecular weight of 290.11 g/mol. Its IUPAC name is 2-[(2,3-dichlorobenzoyl)amino]propanediamide.
| Compound Name | 2-[(2,3-dichlorobenzoyl)amino]propanediamide |
|---|---|
| PubChem CID | 25465611 |
| Molecular Formula | C10H9Cl2N3O3 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 2-[(2,3-dichlorobenzoyl)amino]propanediamide |
| SMILES | NC(=O)C(NC(=O)c1cccc(Cl)c1Cl)C(N)=O |
| InChI | InChI=1S/C10H9Cl2N3O3/c11-5-3-1-2-4(6(5)12)10(18)15-7(8(13)16)9(14)17/h1-3,7H,(H2,13,16)(H2,14,17)(H,15,18) |
| InChIKey | NYBSFRANYNWGMB-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|