C13H13Cl2NO3 — CID 81362646
3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid (PubChem CID 81362646) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid.
| Compound Name | 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 81362646 |
| Molecular Formula | C13H13Cl2NO3 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1cccc(Cl)c1Cl)C1CC1 |
| InChI | InChI=1S/C13H13Cl2NO3/c14-9-3-1-2-8(12(9)15)13(19)16-10(6-11(17)18)7-4-5-7/h1-3,7,10H,4-6H2,(H,16,19)(H,17,18) |
| InChIKey | PHAALZKYNFBOTD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |