3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid

C13H13Cl2NO3 — CID 81362646

IUPAC3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid
SMILESO=C(O)CC(NC(=O)c1cccc(Cl)c1Cl)C1CC1
InChIInChI=1S/C13H13Cl2NO3/c14-9-3-1-2-8(12(9)15)13(19)16-10(6-11(17)18)7-4-5-7/h1-3,7,10H,4-6H2,(H,16,19)(H,17,18)
InChIKeyPHAALZKYNFBOTD-UHFFFAOYSA-N
MW302.16 g/mol
LogP2.98
Rot. Bonds5

About 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid

3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid (PubChem CID 81362646) has the molecular formula C13H13Cl2NO3 and a molecular weight of 302.16 g/mol. Its IUPAC name is 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid.

Molecular Properties

Compound Name3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid
PubChem CID81362646
Molecular FormulaC13H13Cl2NO3
Molecular Weight302.16 g/mol
Exact Mass301.03
IUPAC Name3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid
SMILESO=C(O)CC(NC(=O)c1cccc(Cl)c1Cl)C1CC1
InChIInChI=1S/C13H13Cl2NO3/c14-9-3-1-2-8(12(9)15)13(19)16-10(6-11(17)18)7-4-5-7/h1-3,7,10H,4-6H2,(H,16,19)(H,17,18)
InChIKeyPHAALZKYNFBOTD-UHFFFAOYSA-N
XLogP2.98
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.16
LogP ≤ 52.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid?
The IUPAC name of 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid (CID 81362646) is 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid.
What is the SMILES notation for 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid?
The canonical SMILES for 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid is O=C(O)CC(NC(=O)c1cccc(Cl)c1Cl)C1CC1.
What is the InChIKey of 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid?
The InChIKey is PHAALZKYNFBOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2NO3/c14-9-3-1-2-8(12(9)15)13(19)16-10(6-11(17)18)7-4-5-7/h1-3,7,10H,4-6H2,(H,16,19)(H,17,18).
What are the key properties of 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid?
3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid has a molecular weight of 302.16 g/mol, XLogP of 2.98, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-3-[(2,3-dichlorobenzoyl)amino]propanoic acid is sourced from PubChem (CID 81362646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).