C13H13F2NO3 — CID 81362386
3-cyclopropyl-3-[(2,4-difluorobenzoyl)amino]propanoic acid (PubChem CID 81362386) has the molecular formula C13H13F2NO3 and a molecular weight of 269.25 g/mol. Its IUPAC name is 3-cyclopropyl-3-[(2,4-difluorobenzoyl)amino]propanoic acid.
| Compound Name | 3-cyclopropyl-3-[(2,4-difluorobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 81362386 |
| Molecular Formula | C13H13F2NO3 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-cyclopropyl-3-[(2,4-difluorobenzoyl)amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(F)cc1F)C1CC1 |
| InChI | InChI=1S/C13H13F2NO3/c14-8-3-4-9(10(15)5-8)13(19)16-11(6-12(17)18)7-1-2-7/h3-5,7,11H,1-2,6H2,(H,16,19)(H,17,18) |
| InChIKey | JVZYLWNXVJIKOR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |