C18H21F2N3O2 — CID 18421751
N-[1-(cyanomethylamino)-3-cyclohexyl-1-oxopropan-2-yl]-2,4-difluorobenzamide (PubChem CID 18421751) has the molecular formula C18H21F2N3O2 and a molecular weight of 349.38 g/mol. Its IUPAC name is N-[1-(cyanomethylamino)-3-cyclohexyl-1-oxopropan-2-yl]-2,4-difluorobenzamide.
| Compound Name | N-[1-(cyanomethylamino)-3-cyclohexyl-1-oxopropan-2-yl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 18421751 |
| Molecular Formula | C18H21F2N3O2 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-[1-(cyanomethylamino)-3-cyclohexyl-1-oxopropan-2-yl]-2,4-difluorobenzamide |
| SMILES | N#CCNC(=O)C(CC1CCCCC1)NC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H21F2N3O2/c19-13-6-7-14(15(20)11-13)17(24)23-16(18(25)22-9-8-21)10-12-4-2-1-3-5-12/h6-7,11-12,16H,1-5,9-10H2,(H,22,25)(H,23,24) |
| InChIKey | GEZPTPRQCYFBFG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|