C20H27N3O4 — CID 18421765
N-[1-(cyanomethylamino)-3-cyclohexyl-1-oxopropan-2-yl]-3,4-dimethoxybenzamide (PubChem CID 18421765) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-[1-(cyanomethylamino)-3-cyclohexyl-1-oxopropan-2-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[1-(cyanomethylamino)-3-cyclohexyl-1-oxopropan-2-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 18421765 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-[1-(cyanomethylamino)-3-cyclohexyl-1-oxopropan-2-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(CC2CCCCC2)C(=O)NCC#N)cc1OC |
| InChI | InChI=1S/C20H27N3O4/c1-26-17-9-8-15(13-18(17)27-2)19(24)23-16(20(25)22-11-10-21)12-14-6-4-3-5-7-14/h8-9,13-14,16H,3-7,11-12H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | BUPXEOKOMXIHIO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|