C19H22F3NO3 — CID 59290535
N-(1-cyclohexyl-2,2,2-trifluoroethyl)-3-methoxy-4-prop-2-ynoxybenzamide (PubChem CID 59290535) has the molecular formula C19H22F3NO3 and a molecular weight of 369.38 g/mol. Its IUPAC name is N-(1-cyclohexyl-2,2,2-trifluoroethyl)-3-methoxy-4-prop-2-ynoxybenzamide.
| Compound Name | N-(1-cyclohexyl-2,2,2-trifluoroethyl)-3-methoxy-4-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 59290535 |
| Molecular Formula | C19H22F3NO3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-(1-cyclohexyl-2,2,2-trifluoroethyl)-3-methoxy-4-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1ccc(C(=O)NC(C2CCCCC2)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C19H22F3NO3/c1-3-11-26-15-10-9-14(12-16(15)25-2)18(24)23-17(19(20,21)22)13-7-5-4-6-8-13/h1,9-10,12-13,17H,4-8,11H2,2H3,(H,23,24) |
| InChIKey | COUKLPLSMGYAJO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|