C17H23NO3 — CID 59301808
N-(3,3-dimethylbutan-2-yl)-3-methoxy-4-prop-2-ynoxybenzamide (PubChem CID 59301808) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-3-methoxy-4-prop-2-ynoxybenzamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-3-methoxy-4-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 59301808 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-3-methoxy-4-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1ccc(C(=O)NC(C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C17H23NO3/c1-7-10-21-14-9-8-13(11-15(14)20-6)16(19)18-12(2)17(3,4)5/h1,8-9,11-12H,10H2,2-6H3,(H,18,19) |
| InChIKey | DJQXNGAQMBPVFW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|