C14H15NO5 — CID 79726276
4-methoxy-3-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]oxybenzoic acid (PubChem CID 79726276) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-methoxy-3-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]oxybenzoic acid.
| Compound Name | 4-methoxy-3-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 79726276 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-methoxy-3-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]oxybenzoic acid |
| SMILES | C#CCNC(=O)C(C)Oc1cc(C(=O)O)ccc1OC |
| InChI | InChI=1S/C14H15NO5/c1-4-7-15-13(16)9(2)20-12-8-10(14(17)18)5-6-11(12)19-3/h1,5-6,8-9H,7H2,2-3H3,(H,15,16)(H,17,18) |
| InChIKey | SEXMODLKBZMXDS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|