C15H17NO4 — CID 43112291
2-(2-ethoxy-4-formylphenoxy)-N-prop-2-ynylpropanamide (PubChem CID 43112291) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-(2-ethoxy-4-formylphenoxy)-N-prop-2-ynylpropanamide.
| Compound Name | 2-(2-ethoxy-4-formylphenoxy)-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 43112291 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-(2-ethoxy-4-formylphenoxy)-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)Oc1ccc(C=O)cc1OCC |
| InChI | InChI=1S/C15H17NO4/c1-4-8-16-15(18)11(3)20-13-7-6-12(10-17)9-14(13)19-5-2/h1,6-7,9-11H,5,8H2,2-3H3,(H,16,18) |
| InChIKey | IPVRAXUNWYLNHW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|