C16H23NO4 — CID 43112243
2-(4-formyl-2-methoxyphenoxy)-N-(3-methylbutyl)propanamide (PubChem CID 43112243) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-(4-formyl-2-methoxyphenoxy)-N-(3-methylbutyl)propanamide.
| Compound Name | 2-(4-formyl-2-methoxyphenoxy)-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 43112243 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-(4-formyl-2-methoxyphenoxy)-N-(3-methylbutyl)propanamide |
| SMILES | COc1cc(C=O)ccc1OC(C)C(=O)NCCC(C)C |
| InChI | InChI=1S/C16H23NO4/c1-11(2)7-8-17-16(19)12(3)21-14-6-5-13(10-18)9-15(14)20-4/h5-6,9-12H,7-8H2,1-4H3,(H,17,19) |
| InChIKey | YJUZDHKRHISWJO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|