C15H21NO5 — CID 43112242
2-(4-formyl-2-methoxyphenoxy)-N-(3-methoxypropyl)propanamide (PubChem CID 43112242) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-(4-formyl-2-methoxyphenoxy)-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-(4-formyl-2-methoxyphenoxy)-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 43112242 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-(4-formyl-2-methoxyphenoxy)-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)Oc1ccc(C=O)cc1OC |
| InChI | InChI=1S/C15H21NO5/c1-11(15(18)16-7-4-8-19-2)21-13-6-5-12(10-17)9-14(13)20-3/h5-6,9-11H,4,7-8H2,1-3H3,(H,16,18) |
| InChIKey | QCWBFMFPEHBSGG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|